C7H10Cl3F3 — CID 174826458
1,1,1-trichloro-6,6,6-trifluoro-3-methylhexane (PubChem CID 174826458) has the molecular formula C7H10Cl3F3 and a molecular weight of 257.51 g/mol. Its IUPAC name is 1,1,1-trichloro-6,6,6-trifluoro-3-methylhexane.
| Compound Name | 1,1,1-trichloro-6,6,6-trifluoro-3-methylhexane |
|---|---|
| PubChem CID | 174826458 |
| Molecular Formula | C7H10Cl3F3 |
| Molecular Weight | 257.51 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 1,1,1-trichloro-6,6,6-trifluoro-3-methylhexane |
| SMILES | CC(CCC(F)(F)F)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3F3/c1-5(4-6(8,9)10)2-3-7(11,12)13/h5H,2-4H2,1H3 |
| InChIKey | KMKVLUBIUYDIEF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|