C12H20F6 — CID 162503519
1,1,1,9,9,9-hexafluoro-5-propan-2-ylnonane (PubChem CID 162503519) has the molecular formula C12H20F6 and a molecular weight of 278.28 g/mol. Its IUPAC name is 1,1,1,9,9,9-hexafluoro-5-propan-2-ylnonane.
| Compound Name | 1,1,1,9,9,9-hexafluoro-5-propan-2-ylnonane |
|---|---|
| PubChem CID | 162503519 |
| Molecular Formula | C12H20F6 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1,1,1,9,9,9-hexafluoro-5-propan-2-ylnonane |
| SMILES | CC(C)C(CCCC(F)(F)F)CCCC(F)(F)F |
| InChI | InChI=1S/C12H20F6/c1-9(2)10(5-3-7-11(13,14)15)6-4-8-12(16,17)18/h9-10H,3-8H2,1-2H3 |
| InChIKey | COOAACGOVGIZBD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |