C13H24F3I — CID 142693981
1,1,1-trifluoro-5-(1-iodoethyl)undecane (PubChem CID 142693981) has the molecular formula C13H24F3I and a molecular weight of 364.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-(1-iodoethyl)undecane.
| Compound Name | 1,1,1-trifluoro-5-(1-iodoethyl)undecane |
|---|---|
| PubChem CID | 142693981 |
| Molecular Formula | C13H24F3I |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1,1,1-trifluoro-5-(1-iodoethyl)undecane |
| SMILES | CCCCCCC(CCCC(F)(F)F)C(C)I |
| InChI | InChI=1S/C13H24F3I/c1-3-4-5-6-8-12(11(2)17)9-7-10-13(14,15)16/h11-12H,3-10H2,1-2H3 |
| InChIKey | OSNNTDSHDGAYME-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|