C13H28IN — CID 167004747
4-(1-iodoethyl)-N,N-dimethylnonan-1-amine (PubChem CID 167004747) has the molecular formula C13H28IN and a molecular weight of 325.28 g/mol. Its IUPAC name is 4-(1-iodoethyl)-N,N-dimethylnonan-1-amine.
| Compound Name | 4-(1-iodoethyl)-N,N-dimethylnonan-1-amine |
|---|---|
| PubChem CID | 167004747 |
| Molecular Formula | C13H28IN |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-(1-iodoethyl)-N,N-dimethylnonan-1-amine |
| SMILES | CCCCCC(CCCN(C)C)C(C)I |
| InChI | InChI=1S/C13H28IN/c1-5-6-7-9-13(12(2)14)10-8-11-15(3)4/h12-13H,5-11H2,1-4H3 |
| InChIKey | OVUAEXFSKBSHDP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|