C15H30Cl3N — CID 150712358
N,N-dimethyl-4-(trichloromethyl)dodecan-1-amine (PubChem CID 150712358) has the molecular formula C15H30Cl3N and a molecular weight of 330.77 g/mol. Its IUPAC name is N,N-dimethyl-4-(trichloromethyl)dodecan-1-amine.
| Compound Name | N,N-dimethyl-4-(trichloromethyl)dodecan-1-amine |
|---|---|
| PubChem CID | 150712358 |
| Molecular Formula | C15H30Cl3N |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N,N-dimethyl-4-(trichloromethyl)dodecan-1-amine |
| SMILES | CCCCCCCCC(CCCN(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H30Cl3N/c1-4-5-6-7-8-9-11-14(15(16,17)18)12-10-13-19(2)3/h14H,4-13H2,1-3H3 |
| InChIKey | JODUMMUCILIOHV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|