C14H29F3N2 — CID 115520311
3-propan-2-yl-N'-(5,5,5-trifluoropentyl)hexane-1,6-diamine (PubChem CID 115520311) has the molecular formula C14H29F3N2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-propan-2-yl-N'-(5,5,5-trifluoropentyl)hexane-1,6-diamine.
| Compound Name | 3-propan-2-yl-N'-(5,5,5-trifluoropentyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 115520311 |
| Molecular Formula | C14H29F3N2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3-propan-2-yl-N'-(5,5,5-trifluoropentyl)hexane-1,6-diamine |
| SMILES | CC(C)C(CCN)CCCNCCCCC(F)(F)F |
| InChI | InChI=1S/C14H29F3N2/c1-12(2)13(7-9-18)6-5-11-19-10-4-3-8-14(15,16)17/h12-13,19H,3-11,18H2,1-2H3 |
| InChIKey | ZBOSZAYMOULRHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|