C11H21F3 — CID 126748355
(6R)-1,1,1-trifluoro-3,6,7-trimethyloctane (PubChem CID 126748355) has the molecular formula C11H21F3 and a molecular weight of 210.28 g/mol. Its IUPAC name is (6R)-1,1,1-trifluoro-3,6,7-trimethyloctane.
| Compound Name | (6R)-1,1,1-trifluoro-3,6,7-trimethyloctane |
|---|---|
| PubChem CID | 126748355 |
| Molecular Formula | C11H21F3 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (6R)-1,1,1-trifluoro-3,6,7-trimethyloctane |
| SMILES | CC(CC[C@@H](C)C(C)C)CC(F)(F)F |
| InChI | InChI=1S/C11H21F3/c1-8(2)10(4)6-5-9(3)7-11(12,13)14/h8-10H,5-7H2,1-4H3/t9?,10-/m1/s1 |
| InChIKey | GARHGMJZVSXSDW-QVDQXJPCSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |