About (3R)-5,5-difluoro-2,3-dimethylheptane
(3R)-5,5-difluoro-2,3-dimethylheptane (PubChem CID 118133528) has the molecular formula C9H18F2
and a molecular weight of 164.24 g/mol. Its IUPAC name is (3R)-5,5-difluoro-2,3-dimethylheptane.
Molecular Properties
| Compound Name | (3R)-5,5-difluoro-2,3-dimethylheptane |
| PubChem CID | 118133528 |
| Molecular Formula | C9H18F2 |
| Molecular Weight | 164.24 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | (3R)-5,5-difluoro-2,3-dimethylheptane |
| SMILES | CCC(F)(F)C[C@@H](C)C(C)C |
| InChI | InChI=1S/C9H18F2/c1-5-9(10,11)6-8(4)7(2)3/h7-8H,5-6H2,1-4H3/t8-/m1/s1 |
| InChIKey | CRWYVMAENMOLRY-MRVPVSSYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3R)-5,5-difluoro-2,3-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5,5-difluoro-2,3-dimethylheptane?
The IUPAC name of (3R)-5,5-difluoro-2,3-dimethylheptane (CID 118133528) is (3R)-5,5-difluoro-2,3-dimethylheptane.
What is the SMILES notation for (3R)-5,5-difluoro-2,3-dimethylheptane?
The canonical SMILES for (3R)-5,5-difluoro-2,3-dimethylheptane is CCC(F)(F)C[C@@H](C)C(C)C.
What is the InChIKey of (3R)-5,5-difluoro-2,3-dimethylheptane?
The InChIKey is CRWYVMAENMOLRY-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H18F2/c1-5-9(10,11)6-8(4)7(2)3/h7-8H,5-6H2,1-4H3/t8-/m1/s1.
What are the key properties of (3R)-5,5-difluoro-2,3-dimethylheptane?
(3R)-5,5-difluoro-2,3-dimethylheptane has a molecular weight of 164.24 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5,5-difluoro-2,3-dimethylheptane is sourced from PubChem (CID 118133528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).