About fluoromethane;2-methylpropane;1,1,1-trifluoropropane
fluoromethane;2-methylpropane;1,1,1-trifluoropropane (PubChem CID 161219441) has the molecular formula C8H18F4
and a molecular weight of 190.22 g/mol. Its IUPAC name is fluoromethane;2-methylpropane;1,1,1-trifluoropropane.
Analyze fluoromethane;2-methylpropane;1,1,1-trifluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;2-methylpropane;1,1,1-trifluoropropane?
The IUPAC name of fluoromethane;2-methylpropane;1,1,1-trifluoropropane (CID 161219441) is fluoromethane;2-methylpropane;1,1,1-trifluoropropane.
What is the SMILES notation for fluoromethane;2-methylpropane;1,1,1-trifluoropropane?
The canonical SMILES for fluoromethane;2-methylpropane;1,1,1-trifluoropropane is CC(C)C.CCC(F)(F)F.CF.
What is the InChIKey of fluoromethane;2-methylpropane;1,1,1-trifluoropropane?
The InChIKey is UXHSDZKAUFQDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H5F3.CH3F/c1-4(2)3;1-2-3(4,5)6;1-2/h4H,1-3H3;2H2,1H3;1H3.
What are the key properties of fluoromethane;2-methylpropane;1,1,1-trifluoropropane?
fluoromethane;2-methylpropane;1,1,1-trifluoropropane has a molecular weight of 190.22 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;2-methylpropane;1,1,1-trifluoropropane is sourced from PubChem (CID 161219441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).