C6H12ClF3 — CID 161109938
2-chloro-1,1,1-trifluoroethane;2-methylpropane (PubChem CID 161109938) has the molecular formula C6H12ClF3 and a molecular weight of 176.61 g/mol. Its IUPAC name is 2-chloro-1,1,1-trifluoroethane;2-methylpropane.
| Compound Name | 2-chloro-1,1,1-trifluoroethane;2-methylpropane |
|---|---|
| PubChem CID | 161109938 |
| Molecular Formula | C6H12ClF3 |
| Molecular Weight | 176.61 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-chloro-1,1,1-trifluoroethane;2-methylpropane |
| SMILES | CC(C)C.FC(F)(F)CCl |
| InChI | InChI=1S/C4H10.C2H2ClF3/c1-4(2)3;3-1-2(4,5)6/h4H,1-3H3;1H2 |
| InChIKey | UJOCQOUIHCFVQS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|