C4H4Cl7F — CID 88595352
1,1,1,2-tetrachloroethane;1,1,2-trichloro-1-fluoroethane (PubChem CID 88595352) has the molecular formula C4H4Cl7F and a molecular weight of 319.25 g/mol. Its IUPAC name is 1,1,1,2-tetrachloroethane;1,1,2-trichloro-1-fluoroethane.
| Compound Name | 1,1,1,2-tetrachloroethane;1,1,2-trichloro-1-fluoroethane |
|---|---|
| PubChem CID | 88595352 |
| Molecular Formula | C4H4Cl7F |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 315.81 |
| IUPAC Name | 1,1,1,2-tetrachloroethane;1,1,2-trichloro-1-fluoroethane |
| SMILES | ClCC(Cl)(Cl)Cl.FC(Cl)(Cl)CCl |
| InChI | InChI=1S/C2H2Cl4.C2H2Cl3F/c2*3-1-2(4,5)6/h2*1H2 |
| InChIKey | TYMPUEACOHQMGV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|