C4H5Cl3F4 — CID 157357085
2-chloro-1,1,1-trifluoroethane;1,2-dichloro-1-fluoroethane (PubChem CID 157357085) has the molecular formula C4H5Cl3F4 and a molecular weight of 235.43 g/mol. Its IUPAC name is 2-chloro-1,1,1-trifluoroethane;1,2-dichloro-1-fluoroethane.
| Compound Name | 2-chloro-1,1,1-trifluoroethane;1,2-dichloro-1-fluoroethane |
|---|---|
| PubChem CID | 157357085 |
| Molecular Formula | C4H5Cl3F4 |
| Molecular Weight | 235.43 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | 2-chloro-1,1,1-trifluoroethane;1,2-dichloro-1-fluoroethane |
| SMILES | FC(Cl)CCl.FC(F)(F)CCl |
| InChI | InChI=1S/C2H3Cl2F.C2H2ClF3/c3-1-2(4)5;3-1-2(4,5)6/h2H,1H2;1H2 |
| InChIKey | BIFFUESWUUZPAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|