C6H6Cl2F8 — CID 166072722
3-chloro-1,1,1,2-tetrafluoropropane (PubChem CID 166072722) has the molecular formula C6H6Cl2F8 and a molecular weight of 301.00 g/mol. Its IUPAC name is 3-chloro-1,1,1,2-tetrafluoropropane.
| Compound Name | 3-chloro-1,1,1,2-tetrafluoropropane |
|---|---|
| PubChem CID | 166072722 |
| Molecular Formula | C6H6Cl2F8 |
| Molecular Weight | 301.00 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 3-chloro-1,1,1,2-tetrafluoropropane |
| SMILES | FC(CCl)C(F)(F)F.FC(CCl)C(F)(F)F |
| InChI | InChI=1S/2C3H3ClF4/c2*4-1-2(5)3(6,7)8/h2*2H,1H2 |
| InChIKey | DLTBVTRDZDFQCV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.00 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|