C6H6Cl4F6 — CID 159624580
1,3-dichloro-1,1,3-trifluoropropane;3,3-dichloro-1,1,1-trifluoropropane (PubChem CID 159624580) has the molecular formula C6H6Cl4F6 and a molecular weight of 333.91 g/mol. Its IUPAC name is 1,3-dichloro-1,1,3-trifluoropropane;3,3-dichloro-1,1,1-trifluoropropane.
| Compound Name | 1,3-dichloro-1,1,3-trifluoropropane;3,3-dichloro-1,1,1-trifluoropropane |
|---|---|
| PubChem CID | 159624580 |
| Molecular Formula | C6H6Cl4F6 |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | 1,3-dichloro-1,1,3-trifluoropropane;3,3-dichloro-1,1,1-trifluoropropane |
| SMILES | FC(Cl)CC(F)(F)Cl.FC(F)(F)CC(Cl)Cl |
| InChI | InChI=1S/2C3H3Cl2F3/c4-2(6)1-3(5,7)8;4-2(5)1-3(6,7)8/h2*2H,1H2 |
| InChIKey | MOIAEKHOTIHGLP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|