C6H6F8S2 — CID 88585021
1,1,1,3-tetrafluoro-3-(1,3,3,3-tetrafluoropropyldisulfanyl)propane (PubChem CID 88585021) has the molecular formula C6H6F8S2 and a molecular weight of 294.23 g/mol. Its IUPAC name is 1,1,1,3-tetrafluoro-3-(1,3,3,3-tetrafluoropropyldisulfanyl)propane.
| Compound Name | 1,1,1,3-tetrafluoro-3-(1,3,3,3-tetrafluoropropyldisulfanyl)propane |
|---|---|
| PubChem CID | 88585021 |
| Molecular Formula | C6H6F8S2 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 1,1,1,3-tetrafluoro-3-(1,3,3,3-tetrafluoropropyldisulfanyl)propane |
| SMILES | FC(CC(F)(F)F)SSC(F)CC(F)(F)F |
| InChI | InChI=1S/C6H6F8S2/c7-3(1-5(9,10)11)15-16-4(8)2-6(12,13)14/h3-4H,1-2H2 |
| InChIKey | KJQYAOVBYNLDEN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|