C9H19F3O — CID 161115297
ethene;2-methylpropan-1-ol;1,1,1-trifluoropropane (PubChem CID 161115297) has the molecular formula C9H19F3O and a molecular weight of 200.24 g/mol. Its IUPAC name is ethene;2-methylpropan-1-ol;1,1,1-trifluoropropane.
| Compound Name | ethene;2-methylpropan-1-ol;1,1,1-trifluoropropane |
|---|---|
| PubChem CID | 161115297 |
| Molecular Formula | C9H19F3O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | ethene;2-methylpropan-1-ol;1,1,1-trifluoropropane |
| SMILES | C=C.CC(C)CO.CCC(F)(F)F |
| InChI | InChI=1S/C4H10O.C3H5F3.C2H4/c1-4(2)3-5;1-2-3(4,5)6;1-2/h4-5H,3H2,1-2H3;2H2,1H3;1-2H2 |
| InChIKey | UKFWGWDCBPOAIC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|