C10H18F6 — CID 169212435
ethane;1,1,1,7,7,7-hexafluoro-4-methylheptane (PubChem CID 169212435) has the molecular formula C10H18F6 and a molecular weight of 252.24 g/mol. Its IUPAC name is ethane;1,1,1,7,7,7-hexafluoro-4-methylheptane.
| Compound Name | ethane;1,1,1,7,7,7-hexafluoro-4-methylheptane |
|---|---|
| PubChem CID | 169212435 |
| Molecular Formula | C10H18F6 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | ethane;1,1,1,7,7,7-hexafluoro-4-methylheptane |
| SMILES | CC.CC(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C8H12F6.C2H6/c1-6(2-4-7(9,10)11)3-5-8(12,13)14;1-2/h6H,2-5H2,1H3;1-2H3 |
| InChIKey | QSIGNNGLLFNZPG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |