C11H25F3O — CID 143009498
ethane;pentan-2-ol;1,1,1-trifluorobutane (PubChem CID 143009498) has the molecular formula C11H25F3O and a molecular weight of 230.31 g/mol. Its IUPAC name is ethane;pentan-2-ol;1,1,1-trifluorobutane.
| Compound Name | ethane;pentan-2-ol;1,1,1-trifluorobutane |
|---|---|
| PubChem CID | 143009498 |
| Molecular Formula | C11H25F3O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | ethane;pentan-2-ol;1,1,1-trifluorobutane |
| SMILES | CC.CCCC(C)O.CCCC(F)(F)F |
| InChI | InChI=1S/C5H12O.C4H7F3.C2H6/c1-3-4-5(2)6;1-2-3-4(5,6)7;1-2/h5-6H,3-4H2,1-2H3;2-3H2,1H3;1-2H3 |
| InChIKey | SKEGFDJLLRWKDU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |