C24H50O — CID 174626284
2,3,6-trimethyl-8-(4,7,8-trimethylnonan-2-yloxy)nonane (PubChem CID 174626284) has the molecular formula C24H50O and a molecular weight of 354.66 g/mol. Its IUPAC name is 2,3,6-trimethyl-8-(4,7,8-trimethylnonan-2-yloxy)nonane.
| Compound Name | 2,3,6-trimethyl-8-(4,7,8-trimethylnonan-2-yloxy)nonane |
|---|---|
| PubChem CID | 174626284 |
| Molecular Formula | C24H50O |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 354.39 |
| IUPAC Name | 2,3,6-trimethyl-8-(4,7,8-trimethylnonan-2-yloxy)nonane |
| SMILES | CC(CCC(C)C(C)C)CC(C)OC(C)CC(C)CCC(C)C(C)C |
| InChI | InChI=1S/C24H50O/c1-17(2)21(7)13-11-19(5)15-23(9)25-24(10)16-20(6)12-14-22(8)18(3)4/h17-24H,11-16H2,1-10H3 |
| InChIKey | YWJJZZIEULYHIN-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |