C17H37N — CID 146513187
N,2,4,6,9,10-hexamethylundecan-3-amine (PubChem CID 146513187) has the molecular formula C17H37N and a molecular weight of 255.49 g/mol. Its IUPAC name is N,2,4,6,9,10-hexamethylundecan-3-amine.
| Compound Name | N,2,4,6,9,10-hexamethylundecan-3-amine |
|---|---|
| PubChem CID | 146513187 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | N,2,4,6,9,10-hexamethylundecan-3-amine |
| SMILES | CNC(C(C)C)C(C)CC(C)CCC(C)C(C)C |
| InChI | InChI=1S/C17H37N/c1-12(2)15(6)10-9-14(5)11-16(7)17(18-8)13(3)4/h12-18H,9-11H2,1-8H3 |
| InChIKey | YEMHITYNQFLFJO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |