C11H25N — CID 105017383
N,2,3,5-tetramethylheptan-4-amine (PubChem CID 105017383) has the molecular formula C11H25N and a molecular weight of 171.33 g/mol. Its IUPAC name is N,2,3,5-tetramethylheptan-4-amine.
| Compound Name | N,2,3,5-tetramethylheptan-4-amine |
|---|---|
| PubChem CID | 105017383 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | N,2,3,5-tetramethylheptan-4-amine |
| SMILES | CCC(C)C(NC)C(C)C(C)C |
| InChI | InChI=1S/C11H25N/c1-7-9(4)11(12-6)10(5)8(2)3/h8-12H,7H2,1-6H3 |
| InChIKey | BBDJWSRXIDPISG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |