About N-ethyl-3,5-dimethylheptan-4-amine
N-ethyl-3,5-dimethylheptan-4-amine (PubChem CID 79446924) has the molecular formula C11H25N
and a molecular weight of 171.33 g/mol. Its IUPAC name is N-ethyl-3,5-dimethylheptan-4-amine.
Molecular Properties
| Compound Name | N-ethyl-3,5-dimethylheptan-4-amine |
| PubChem CID | 79446924 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | N-ethyl-3,5-dimethylheptan-4-amine |
| SMILES | CCNC(C(C)CC)C(C)CC |
| InChI | InChI=1S/C11H25N/c1-6-9(4)11(12-8-3)10(5)7-2/h9-12H,6-8H2,1-5H3 |
| InChIKey | HBSYUIUISSCBOD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-3,5-dimethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,5-dimethylheptan-4-amine?
The IUPAC name of N-ethyl-3,5-dimethylheptan-4-amine (CID 79446924) is N-ethyl-3,5-dimethylheptan-4-amine.
What is the SMILES notation for N-ethyl-3,5-dimethylheptan-4-amine?
The canonical SMILES for N-ethyl-3,5-dimethylheptan-4-amine is CCNC(C(C)CC)C(C)CC.
What is the InChIKey of N-ethyl-3,5-dimethylheptan-4-amine?
The InChIKey is HBSYUIUISSCBOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N/c1-6-9(4)11(12-8-3)10(5)7-2/h9-12H,6-8H2,1-5H3.
What are the key properties of N-ethyl-3,5-dimethylheptan-4-amine?
N-ethyl-3,5-dimethylheptan-4-amine has a molecular weight of 171.33 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,5-dimethylheptan-4-amine is sourced from PubChem (CID 79446924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).