C8H20N2 — CID 62066397
2-N-ethyl-3-methylpentane-1,2-diamine (PubChem CID 62066397) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is 2-N-ethyl-3-methylpentane-1,2-diamine.
| Compound Name | 2-N-ethyl-3-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 62066397 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 2-N-ethyl-3-methylpentane-1,2-diamine |
| SMILES | CCNC(CN)C(C)CC |
| InChI | InChI=1S/C8H20N2/c1-4-7(3)8(6-9)10-5-2/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | QFMYFJUUNSDGTM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |