C8H16F2 — CID 137419857
1,1-difluoro-4,5-dimethylhexane (PubChem CID 137419857) has the molecular formula C8H16F2 and a molecular weight of 150.21 g/mol. Its IUPAC name is 1,1-difluoro-4,5-dimethylhexane.
| Compound Name | 1,1-difluoro-4,5-dimethylhexane |
|---|---|
| PubChem CID | 137419857 |
| Molecular Formula | C8H16F2 |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1,1-difluoro-4,5-dimethylhexane |
| SMILES | CC(C)C(C)CCC(F)F |
| InChI | InChI=1S/C8H16F2/c1-6(2)7(3)4-5-8(9)10/h6-8H,4-5H2,1-3H3 |
| InChIKey | BSAHPDFGBYOFFF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |