About 1,1-difluoro-4,5-dimethylhexane
1,1-difluoro-4,5-dimethylhexane (PubChem CID 137419857) has the molecular formula C8H16F2
and a molecular weight of 150.21 g/mol. Its IUPAC name is 1,1-difluoro-4,5-dimethylhexane.
Molecular Properties
| Compound Name | 1,1-difluoro-4,5-dimethylhexane |
| PubChem CID | 137419857 |
| Molecular Formula | C8H16F2 |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1,1-difluoro-4,5-dimethylhexane |
| SMILES | CC(C)C(C)CCC(F)F |
| InChI | InChI=1S/C8H16F2/c1-6(2)7(3)4-5-8(9)10/h6-8H,4-5H2,1-3H3 |
| InChIKey | BSAHPDFGBYOFFF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluoro-4,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-4,5-dimethylhexane?
The IUPAC name of 1,1-difluoro-4,5-dimethylhexane (CID 137419857) is 1,1-difluoro-4,5-dimethylhexane.
What is the SMILES notation for 1,1-difluoro-4,5-dimethylhexane?
The canonical SMILES for 1,1-difluoro-4,5-dimethylhexane is CC(C)C(C)CCC(F)F.
What is the InChIKey of 1,1-difluoro-4,5-dimethylhexane?
The InChIKey is BSAHPDFGBYOFFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2/c1-6(2)7(3)4-5-8(9)10/h6-8H,4-5H2,1-3H3.
What are the key properties of 1,1-difluoro-4,5-dimethylhexane?
1,1-difluoro-4,5-dimethylhexane has a molecular weight of 150.21 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-4,5-dimethylhexane is sourced from PubChem (CID 137419857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).