C12H25Br — CID 123690238
6-bromo-2,3,7-trimethylnonane (PubChem CID 123690238) has the molecular formula C12H25Br and a molecular weight of 249.24 g/mol. Its IUPAC name is 6-bromo-2,3,7-trimethylnonane.
| Compound Name | 6-bromo-2,3,7-trimethylnonane |
|---|---|
| PubChem CID | 123690238 |
| Molecular Formula | C12H25Br |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-bromo-2,3,7-trimethylnonane |
| SMILES | CCC(C)C(Br)CCC(C)C(C)C |
| InChI | InChI=1S/C12H25Br/c1-6-10(4)12(13)8-7-11(5)9(2)3/h9-12H,6-8H2,1-5H3 |
| InChIKey | ZNWOZCQEHMSWSR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|