C22H40Cl6 — CID 150612565
1,1,1,21,21,21-hexachloro-11-methylhenicosane (PubChem CID 150612565) has the molecular formula C22H40Cl6 and a molecular weight of 517.28 g/mol. Its IUPAC name is 1,1,1,21,21,21-hexachloro-11-methylhenicosane.
| Compound Name | 1,1,1,21,21,21-hexachloro-11-methylhenicosane |
|---|---|
| PubChem CID | 150612565 |
| Molecular Formula | C22H40Cl6 |
| Molecular Weight | 517.28 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 1,1,1,21,21,21-hexachloro-11-methylhenicosane |
| SMILES | CC(CCCCCCCCCC(Cl)(Cl)Cl)CCCCCCCCCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H40Cl6/c1-20(16-12-8-4-2-6-10-14-18-21(23,24)25)17-13-9-5-3-7-11-15-19-22(26,27)28/h20H,2-19H2,1H3 |
| InChIKey | IUFFJIMKQVDQFP-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.28 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|