C5H3Br2Cl4F3 — CID 119097203
1,3-dibromo-2,5,5,5-tetrachloro-1,1,2-trifluoropentane (PubChem CID 119097203) has the molecular formula C5H3Br2Cl4F3 and a molecular weight of 421.69 g/mol. Its IUPAC name is 1,3-dibromo-2,5,5,5-tetrachloro-1,1,2-trifluoropentane.
| Compound Name | 1,3-dibromo-2,5,5,5-tetrachloro-1,1,2-trifluoropentane |
|---|---|
| PubChem CID | 119097203 |
| Molecular Formula | C5H3Br2Cl4F3 |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 417.73 |
| IUPAC Name | 1,3-dibromo-2,5,5,5-tetrachloro-1,1,2-trifluoropentane |
| SMILES | FC(F)(Br)C(F)(Cl)C(Br)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H3Br2Cl4F3/c6-2(1-3(8,9)10)4(11,12)5(7,13)14/h2H,1H2 |
| InChIKey | HNDJQFMHDCUXFT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|