C4H6Cl6Si — CID 12527128
dichloro-methyl-(1,3,3,3-tetrachloropropyl)silane (PubChem CID 12527128) has the molecular formula C4H6Cl6Si and a molecular weight of 294.90 g/mol. Its IUPAC name is dichloro-methyl-(1,3,3,3-tetrachloropropyl)silane.
| Compound Name | dichloro-methyl-(1,3,3,3-tetrachloropropyl)silane |
|---|---|
| PubChem CID | 12527128 |
| Molecular Formula | C4H6Cl6Si |
| Molecular Weight | 294.90 g/mol |
| Exact Mass | 291.84 |
| IUPAC Name | dichloro-methyl-(1,3,3,3-tetrachloropropyl)silane |
| SMILES | C[Si](Cl)(Cl)C(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H6Cl6Si/c1-11(9,10)3(5)2-4(6,7)8/h3H,2H2,1H3 |
| InChIKey | PCZXEVIFZPGEOV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|