C6H11Cl5Si — CID 139772262
chloro-dimethyl-(1,4,4,4-tetrachlorobutyl)silane (PubChem CID 139772262) has the molecular formula C6H11Cl5Si and a molecular weight of 288.51 g/mol. Its IUPAC name is chloro-dimethyl-(1,4,4,4-tetrachlorobutyl)silane.
| Compound Name | chloro-dimethyl-(1,4,4,4-tetrachlorobutyl)silane |
|---|---|
| PubChem CID | 139772262 |
| Molecular Formula | C6H11Cl5Si |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | chloro-dimethyl-(1,4,4,4-tetrachlorobutyl)silane |
| SMILES | C[Si](C)(Cl)C(Cl)CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H11Cl5Si/c1-12(2,11)5(7)3-4-6(8,9)10/h5H,3-4H2,1-2H3 |
| InChIKey | PZCMOOZKGJGYJU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|