C3H4Cl2F4Si — CID 139648845
dichloro-methyl-(1,2,2,2-tetrafluoroethyl)silane (PubChem CID 139648845) has the molecular formula C3H4Cl2F4Si and a molecular weight of 215.05 g/mol. Its IUPAC name is dichloro-methyl-(1,2,2,2-tetrafluoroethyl)silane.
| Compound Name | dichloro-methyl-(1,2,2,2-tetrafluoroethyl)silane |
|---|---|
| PubChem CID | 139648845 |
| Molecular Formula | C3H4Cl2F4Si |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.94 |
| IUPAC Name | dichloro-methyl-(1,2,2,2-tetrafluoroethyl)silane |
| SMILES | C[Si](Cl)(Cl)C(F)C(F)(F)F |
| InChI | InChI=1S/C3H4Cl2F4Si/c1-10(4,5)2(6)3(7,8)9/h2H,1H3 |
| InChIKey | CXFYHMUSCULTEL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|