C3H4Cl3F3Si — CID 13222400
trichloro(1,1,1-trifluoropropan-2-yl)silane (PubChem CID 13222400) has the molecular formula C3H4Cl3F3Si and a molecular weight of 231.50 g/mol. Its IUPAC name is trichloro(1,1,1-trifluoropropan-2-yl)silane.
| Compound Name | trichloro(1,1,1-trifluoropropan-2-yl)silane |
|---|---|
| PubChem CID | 13222400 |
| Molecular Formula | C3H4Cl3F3Si |
| Molecular Weight | 231.50 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | trichloro(1,1,1-trifluoropropan-2-yl)silane |
| SMILES | CC(C(F)(F)F)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C3H4Cl3F3Si/c1-2(3(7,8)9)10(4,5)6/h2H,1H3 |
| InChIKey | ZGNDEYWIPCARBF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|