About tetrachlorosilane;tetrafluoromethane
tetrachlorosilane;tetrafluoromethane (PubChem CID 174408151) has the molecular formula CCl4F4Si
and a molecular weight of 257.90 g/mol. Its IUPAC name is tetrachlorosilane;tetrafluoromethane.
Molecular Properties
| Compound Name | tetrachlorosilane;tetrafluoromethane |
| PubChem CID | 174408151 |
| Molecular Formula | CCl4F4Si |
| Molecular Weight | 257.90 g/mol |
| Exact Mass | 255.85 |
| IUPAC Name | tetrachlorosilane;tetrafluoromethane |
| SMILES | Cl[Si](Cl)(Cl)Cl.FC(F)(F)F |
| InChI | InChI=1S/CF4.Cl4Si/c2-1(3,4)5;1-5(2,3)4 |
| InChIKey | TZCRUNLZLYSNCJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze tetrachlorosilane;tetrafluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrachlorosilane;tetrafluoromethane?
The IUPAC name of tetrachlorosilane;tetrafluoromethane (CID 174408151) is tetrachlorosilane;tetrafluoromethane.
What is the SMILES notation for tetrachlorosilane;tetrafluoromethane?
The canonical SMILES for tetrachlorosilane;tetrafluoromethane is Cl[Si](Cl)(Cl)Cl.FC(F)(F)F.
What is the InChIKey of tetrachlorosilane;tetrafluoromethane?
The InChIKey is TZCRUNLZLYSNCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CF4.Cl4Si/c2-1(3,4)5;1-5(2,3)4.
What are the key properties of tetrachlorosilane;tetrafluoromethane?
tetrachlorosilane;tetrafluoromethane has a molecular weight of 257.90 g/mol, XLogP of 3.85, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrachlorosilane;tetrafluoromethane is sourced from PubChem (CID 174408151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).