C4H6ClF5Si — CID 87645624
chloro-dimethyl-(1,1,2,2,2-pentafluoroethyl)silane (PubChem CID 87645624) has the molecular formula C4H6ClF5Si and a molecular weight of 212.62 g/mol. Its IUPAC name is chloro-dimethyl-(1,1,2,2,2-pentafluoroethyl)silane.
| Compound Name | chloro-dimethyl-(1,1,2,2,2-pentafluoroethyl)silane |
|---|---|
| PubChem CID | 87645624 |
| Molecular Formula | C4H6ClF5Si |
| Molecular Weight | 212.62 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | chloro-dimethyl-(1,1,2,2,2-pentafluoroethyl)silane |
| SMILES | C[Si](C)(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H6ClF5Si/c1-11(2,5)4(9,10)3(6,7)8/h1-2H3 |
| InChIKey | LISRFEZYVXWSQI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|