C6H4Cl2F10Si — CID 139664652
dichloro-bis(2,2,3,3,3-pentafluoropropyl)silane (PubChem CID 139664652) has the molecular formula C6H4Cl2F10Si and a molecular weight of 365.07 g/mol. Its IUPAC name is dichloro-bis(2,2,3,3,3-pentafluoropropyl)silane.
| Compound Name | dichloro-bis(2,2,3,3,3-pentafluoropropyl)silane |
|---|---|
| PubChem CID | 139664652 |
| Molecular Formula | C6H4Cl2F10Si |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | dichloro-bis(2,2,3,3,3-pentafluoropropyl)silane |
| SMILES | FC(F)(F)C(F)(F)C[Si](Cl)(Cl)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4Cl2F10Si/c7-19(8,1-3(9,10)5(13,14)15)2-4(11,12)6(16,17)18/h1-2H2 |
| InChIKey | BNKQQMUMFCFZCF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|