C12H8Cl2F18Si — CID 121233877
dichloro-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (PubChem CID 121233877) has the molecular formula C12H8Cl2F18Si and a molecular weight of 593.15 g/mol. Its IUPAC name is dichloro-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane.
| Compound Name | dichloro-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 121233877 |
| Molecular Formula | C12H8Cl2F18Si |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 591.95 |
| IUPAC Name | dichloro-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8Cl2F18Si/c13-33(14,3-1-5(15,16)7(19,20)9(23,24)11(27,28)29)4-2-6(17,18)8(21,22)10(25,26)12(30,31)32/h1-4H2 |
| InChIKey | WFXXNIVPFZNJIT-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|