C5H4ClF9 — CID 88674301
1-chloro-1,2,2-trifluoroethane;1,1,1,2,2,3-hexafluoropropane (PubChem CID 88674301) has the molecular formula C5H4ClF9 and a molecular weight of 270.52 g/mol. Its IUPAC name is 1-chloro-1,2,2-trifluoroethane;1,1,1,2,2,3-hexafluoropropane.
| Compound Name | 1-chloro-1,2,2-trifluoroethane;1,1,1,2,2,3-hexafluoropropane |
|---|---|
| PubChem CID | 88674301 |
| Molecular Formula | C5H4ClF9 |
| Molecular Weight | 270.52 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 1-chloro-1,2,2-trifluoroethane;1,1,1,2,2,3-hexafluoropropane |
| SMILES | FC(F)C(F)Cl.FCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3H2F6.C2H2ClF3/c4-1-2(5,6)3(7,8)9;3-1(4)2(5)6/h1H2;1-2H |
| InChIKey | PXDGCHCGTVKQLW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|