C9H7F13 — CID 173149555
1,1,3,3,4,4,5,5,6,6,7,7,8-tridecafluoro-2-methyloctane (PubChem CID 173149555) has the molecular formula C9H7F13 and a molecular weight of 362.13 g/mol. Its IUPAC name is 1,1,3,3,4,4,5,5,6,6,7,7,8-tridecafluoro-2-methyloctane.
| Compound Name | 1,1,3,3,4,4,5,5,6,6,7,7,8-tridecafluoro-2-methyloctane |
|---|---|
| PubChem CID | 173149555 |
| Molecular Formula | C9H7F13 |
| Molecular Weight | 362.13 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 1,1,3,3,4,4,5,5,6,6,7,7,8-tridecafluoro-2-methyloctane |
| SMILES | CC(C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C9H7F13/c1-3(4(11)12)6(15,16)8(19,20)9(21,22)7(17,18)5(13,14)2-10/h3-4H,2H2,1H3 |
| InChIKey | MIXFVZFMTNEABK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.13 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|