C17H12F26N+ — CID 163324373
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-hexacosafluorotetradecyl(trimethyl)azanium (PubChem CID 163324373) has the molecular formula C17H12F26N+ and a molecular weight of 724.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-hexacosafluorotetradecyl(trimethyl)azanium.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-hexacosafluorotetradecyl(trimethyl)azanium |
|---|---|
| PubChem CID | 163324373 |
| Molecular Formula | C17H12F26N+ |
| Molecular Weight | 724.24 g/mol |
| Exact Mass | 724.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-hexacosafluorotetradecyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C17H12F26N/c1-44(2,3)4-6(20,21)8(24,25)10(28,29)12(32,33)14(36,37)16(40,41)17(42,43)15(38,39)13(34,35)11(30,31)9(26,27)7(22,23)5(18)19/h5H,4H2,1-3H3/q+1 |
| InChIKey | FZFDKQGOSXJCNH-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.24 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|