C14H9F24O3P — CID 87827924
bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-trihydroxy-λ5-phosphane (PubChem CID 87827924) has the molecular formula C14H9F24O3P and a molecular weight of 712.15 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-trihydroxy-λ5-phosphane.
| Compound Name | bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-trihydroxy-λ5-phosphane |
|---|---|
| PubChem CID | 87827924 |
| Molecular Formula | C14H9F24O3P |
| Molecular Weight | 712.15 g/mol |
| Exact Mass | 711.99 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-trihydroxy-λ5-phosphane |
| SMILES | OP(O)(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H9F24O3P/c15-3(16)7(23,24)11(31,32)13(35,36)9(27,28)5(19,20)1-42(39,40,41)2-6(21,22)10(29,30)14(37,38)12(33,34)8(25,26)4(17)18/h3-4,39-41H,1-2H2 |
| InChIKey | WOKZODIUFIXXDZ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.15 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|