C7H4F12O — CID 23150346
1,2,2,3,3,4,4,5,5,6,6,7-dodecafluoroheptan-1-ol (PubChem CID 23150346) has the molecular formula C7H4F12O and a molecular weight of 332.08 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7-dodecafluoroheptan-1-ol.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7-dodecafluoroheptan-1-ol |
|---|---|
| PubChem CID | 23150346 |
| Molecular Formula | C7H4F12O |
| Molecular Weight | 332.08 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7-dodecafluoroheptan-1-ol |
| SMILES | OC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C7H4F12O/c8-1-3(10,11)5(14,15)7(18,19)6(16,17)4(12,13)2(9)20/h2,20H,1H2 |
| InChIKey | XTXPJPILJVPUGS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.08 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|