C8H6F13NO2 — CID 173106088
azane;2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorooctanoic acid (PubChem CID 173106088) has the molecular formula C8H6F13NO2 and a molecular weight of 395.12 g/mol. Its IUPAC name is azane;2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorooctanoic acid.
| Compound Name | azane;2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorooctanoic acid |
|---|---|
| PubChem CID | 173106088 |
| Molecular Formula | C8H6F13NO2 |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | azane;2,2,3,3,4,4,5,5,6,6,7,7,8-tridecafluorooctanoic acid |
| SMILES | N.O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C8H3F13O2.H3N/c9-1-3(10,11)5(14,15)7(18,19)8(20,21)6(16,17)4(12,13)2(22)23;/h1H2,(H,22,23);1H3 |
| InChIKey | RCOKVKURDKNPQJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|