C8H3F13O2 — CID 163324893
2,2,3,3,4,4,5,5,6,6,8,8,8-tridecafluorooctanoic acid (PubChem CID 163324893) has the molecular formula C8H3F13O2 and a molecular weight of 378.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,8,8,8-tridecafluorooctanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,8,8,8-tridecafluorooctanoic acid |
|---|---|
| PubChem CID | 163324893 |
| Molecular Formula | C8H3F13O2 |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,8,8,8-tridecafluorooctanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C8H3F13O2/c9-3(10,1-4(11,12)13)6(16,17)8(20,21)7(18,19)5(14,15)2(22)23/h1H2,(H,22,23) |
| InChIKey | DPQQJVHQPPNUIR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|