C8H3F13O2 — CID 171060417
2,3-difluoro-3-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexyl)oxiran-2-ol (PubChem CID 171060417) has the molecular formula C8H3F13O2 and a molecular weight of 378.08 g/mol. Its IUPAC name is 2,3-difluoro-3-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexyl)oxiran-2-ol.
| Compound Name | 2,3-difluoro-3-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexyl)oxiran-2-ol |
|---|---|
| PubChem CID | 171060417 |
| Molecular Formula | C8H3F13O2 |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 2,3-difluoro-3-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexyl)oxiran-2-ol |
| SMILES | OC1(F)OC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C8H3F13O2/c9-1-2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20)8(21,22)23-7/h22H,1H2 |
| InChIKey | XRNIUPJDTYEYCH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|