C7F14O — CID 88593540
2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(1,1,2,2,2-pentafluoroethyl)oxirane (PubChem CID 88593540) has the molecular formula C7F14O and a molecular weight of 366.05 g/mol. Its IUPAC name is 2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(1,1,2,2,2-pentafluoroethyl)oxirane.
| Compound Name | 2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(1,1,2,2,2-pentafluoroethyl)oxirane |
|---|---|
| PubChem CID | 88593540 |
| Molecular Formula | C7F14O |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 2,3-difluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-(1,1,2,2,2-pentafluoroethyl)oxirane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1(F)OC1(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F14O/c8-1(9,2(10,11)6(16,17)18)4(14)5(15,22-4)3(12,13)7(19,20)21 |
| InChIKey | LFUODFBQLVQAOS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|