C9Cl2F16O2 — CID 172847592
4,5-dichloro-4,5-difluoro-2,2-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane (PubChem CID 172847592) has the molecular formula C9Cl2F16O2 and a molecular weight of 514.97 g/mol. Its IUPAC name is 4,5-dichloro-4,5-difluoro-2,2-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane.
| Compound Name | 4,5-dichloro-4,5-difluoro-2,2-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 172847592 |
| Molecular Formula | C9Cl2F16O2 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 513.90 |
| IUPAC Name | 4,5-dichloro-4,5-difluoro-2,2-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1(C(F)(F)C(F)(F)C(F)(F)F)OC(F)(Cl)C(F)(Cl)O1 |
| InChI | InChI=1S/C9Cl2F16O2/c10-6(20)7(11,21)29-5(28-6,1(12,13)3(16,17)8(22,23)24)2(14,15)4(18,19)9(25,26)27 |
| InChIKey | XQEDPWXKJQCPGA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|