C4ClF7O — CID 14045703
2-chloro-3-fluoro-2,3-bis(trifluoromethyl)oxirane (PubChem CID 14045703) has the molecular formula C4ClF7O and a molecular weight of 232.48 g/mol. Its IUPAC name is 2-chloro-3-fluoro-2,3-bis(trifluoromethyl)oxirane.
| Compound Name | 2-chloro-3-fluoro-2,3-bis(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 14045703 |
| Molecular Formula | C4ClF7O |
| Molecular Weight | 232.48 g/mol |
| Exact Mass | 231.95 |
| IUPAC Name | 2-chloro-3-fluoro-2,3-bis(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)C1(F)OC1(Cl)C(F)(F)F |
| InChI | InChI=1S/C4ClF7O/c5-1(3(7,8)9)2(6,13-1)4(10,11)12 |
| InChIKey | GIXAFCYAWBCQAA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|