C3H2F6O5S — CID 87965023
sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane (PubChem CID 87965023) has the molecular formula C3H2F6O5S and a molecular weight of 264.10 g/mol. Its IUPAC name is sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane.
| Compound Name | sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 87965023 |
| Molecular Formula | C3H2F6O5S |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane |
| SMILES | FC(F)(F)C1(F)OC1(F)F.O=S(=O)(O)O |
| InChI | InChI=1S/C3F6O.H2O4S/c4-1(2(5,6)7)3(8,9)10-1;1-5(2,3)4/h;(H2,1,2,3,4) |
| InChIKey | GGQVFZXYPFQUGP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|