sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane

C3H2F6O5S — CID 87965023

IUPACsulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane
SMILESFC(F)(F)C1(F)OC1(F)F.O=S(=O)(O)O
InChIInChI=1S/C3F6O.H2O4S/c4-1(2(5,6)7)3(8,9)10-1;1-5(2,3)4/h;(H2,1,2,3,4)
InChIKeyGGQVFZXYPFQUGP-UHFFFAOYSA-N
MW264.10 g/mol
LogP1.18
Rot. Bonds

About sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane

sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane (PubChem CID 87965023) has the molecular formula C3H2F6O5S and a molecular weight of 264.10 g/mol. Its IUPAC name is sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane.

Molecular Properties

Compound Namesulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane
PubChem CID87965023
Molecular FormulaC3H2F6O5S
Molecular Weight264.10 g/mol
Exact Mass263.95
IUPAC Namesulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane
SMILESFC(F)(F)C1(F)OC1(F)F.O=S(=O)(O)O
InChIInChI=1S/C3F6O.H2O4S/c4-1(2(5,6)7)3(8,9)10-1;1-5(2,3)4/h;(H2,1,2,3,4)
InChIKeyGGQVFZXYPFQUGP-UHFFFAOYSA-N
XLogP1.18
TPSA87.13 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.10
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
The IUPAC name of sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane (CID 87965023) is sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane.
What is the SMILES notation for sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
The canonical SMILES for sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane is FC(F)(F)C1(F)OC1(F)F.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
The InChIKey is GGQVFZXYPFQUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3F6O.H2O4S/c4-1(2(5,6)7)3(8,9)10-1;1-5(2,3)4/h;(H2,1,2,3,4).
What are the key properties of sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane has a molecular weight of 264.10 g/mol, XLogP of 1.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;2,2,3-trifluoro-3-(trifluoromethyl)oxirane is sourced from PubChem (CID 87965023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).