C6HF11KO3 — CID 175824010
CID 175824010 (PubChem CID 175824010) has the molecular formula C6HF11KO3 and a molecular weight of 369.15 g/mol.
| Compound Name | CID 175824010 |
|---|---|
| PubChem CID | 175824010 |
| Molecular Formula | C6HF11KO3 |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | — |
| SMILES | OC(F)(F)C1(C(F)(F)F)OC(F)(F)C(F)(C(F)(F)F)O1.[K] |
| InChI | InChI=1S/C6HF11O3.K/c7-1(3(8,9)10)6(16,17)20-2(19-1,4(11,12)13)5(14,15)18;/h18H; |
| InChIKey | BFWHSYMWUQYXGJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |