C7H8F6O2 — CID 174909301
butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane (PubChem CID 174909301) has the molecular formula C7H8F6O2 and a molecular weight of 238.13 g/mol. Its IUPAC name is butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane.
| Compound Name | butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 174909301 |
| Molecular Formula | C7H8F6O2 |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane |
| SMILES | CCCC=O.FC(F)(F)C1(F)OC1(F)F |
| InChI | InChI=1S/C4H8O.C3F6O/c1-2-3-4-5;4-1(2(5,6)7)3(8,9)10-1/h4H,2-3H2,1H3; |
| InChIKey | RHEYJKOOCKEGDH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|