About butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane
butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane (PubChem CID 174909301) has the molecular formula C7H8F6O2
and a molecular weight of 238.13 g/mol. Its IUPAC name is butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane.
Molecular Properties
| Compound Name | butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane |
| PubChem CID | 174909301 |
| Molecular Formula | C7H8F6O2 |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane |
| SMILES | CCCC=O.FC(F)(F)C1(F)OC1(F)F |
| InChI | InChI=1S/C4H8O.C3F6O/c1-2-3-4-5;4-1(2(5,6)7)3(8,9)10-1/h4H,2-3H2,1H3; |
| InChIKey | RHEYJKOOCKEGDH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
The IUPAC name of butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane (CID 174909301) is butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane.
What is the SMILES notation for butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
The canonical SMILES for butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane is CCCC=O.FC(F)(F)C1(F)OC1(F)F.
What is the InChIKey of butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
The InChIKey is RHEYJKOOCKEGDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3F6O/c1-2-3-4-5;4-1(2(5,6)7)3(8,9)10-1/h4H,2-3H2,1H3;.
What are the key properties of butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane?
butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane has a molecular weight of 238.13 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanal;2,2,3-trifluoro-3-(trifluoromethyl)oxirane is sourced from PubChem (CID 174909301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).