C9H4F12O5 — CID 163957329
2,3,3,3-tetrafluoro-2-[[2,3,5,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-1,4-dioxan-2-yl]oxy]propanoic acid (PubChem CID 163957329) has the molecular formula C9H4F12O5 and a molecular weight of 420.10 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-[[2,3,5,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-1,4-dioxan-2-yl]oxy]propanoic acid.
| Compound Name | 2,3,3,3-tetrafluoro-2-[[2,3,5,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-1,4-dioxan-2-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 163957329 |
| Molecular Formula | C9H4F12O5 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-[[2,3,5,5,6-pentafluoro-3-methyl-6-(trifluoromethyl)-1,4-dioxan-2-yl]oxy]propanoic acid |
| SMILES | CC1(F)OC(F)(F)C(F)(C(F)(F)F)OC1(F)OC(F)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H4F12O5/c1-3(10)9(21,25-4(11,2(22)23)6(13,14)15)26-5(12,7(16,17)18)8(19,20)24-3/h1H3,(H,22,23) |
| InChIKey | WZWYPZQVKVXGQN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |